|
Abbreviated name: CPT
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
3
|
|
Hydrogen bond donors
|
1
|
|
Rotatable bonds
|
1
|
|
Topological polar surface area
|
72.68
|
|
Molecular weight
|
248.13
|
|
XLogP
|
3.26
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
Cn1c2nc([nH]c2c(=O)n(c1=O)C)C1CCCC1
|
|
Isomeric SMILES
|
Cn1c2nc([nH]c2c(=O)n(c1=O)C)C1CCCC1
|
|
InChI
|
InChI=1S/C12H16N4O2/c1-15-10-8(11(17)16(2)12(15)18)13-9(14-10)7-5-3-4-6-7/h7H,3-6H2,1-2H3,(H,13,14)
|
|
InChI Key
|
SCVHFRLUNIOSGI-UHFFFAOYSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|