| 
                                                                Synonyms: imidapril hydrochloride
                                 imidapril is an approved drug 
                                    
                                        Comment: Imidapril is an ACE inhibitor, administered as a prodrug which is then metabolised to the active form, imidaprilat.
                                    
                                 |  | 
                                                
                                        
                                           
                                                
                                                    | 2D Structure   
                                                                    |  
                                                    |   |  
                                                    | Physico-chemical Properties   
                                                                    |  |  
                                                        | 
                                                    
                                                        | Hydrogen bond acceptors | 9 |  
                                                        | Hydrogen bond donors | 2 |  
                                                        | Rotatable bonds | 11 |  
                                                        | Topological polar surface area | 116.25 |  
                                                        | Molecular weight | 405.19 |  
                                                        | XLogP | 1.05 |  
                                                        | No. Lipinski's rules broken | 0 |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  
                                                    | SMILES / InChI / InChIKey   
                                                                    |  |  
                                                        | 
                                                              
                                                                  
                                                            | Canonical SMILES | CCOC(=O)C(NC(C(=O)N1C(=O)N(CC1C(=O)O)C)C)CCc1ccccc1 |  
                                                            | Isomeric SMILES | CCOC(=O)[C@@H](N[C@H](C(=O)N1C(=O)N(C[C@H]1C(=O)O)C)C)CCc1ccccc1 |  
                                                            | InChI | InChI=1S/C20H27N3O6/c1-4-29-19(27)15(11-10-14-8-6-5-7-9-14)21-13(2)17(24)23-16(18(25)26)12-22(3)20(23)28/h5-9,13,15-16,21H,4,10-12H2,1-3H3,(H,25,26)/t13-,15-,16-/m0/s1 |  
                                                            | InChI Key | KLZWOWYOHUKJIG-BPUTZDHNSA-N |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  |