|
Abbreviated name: L-Asn
Compound class:
Metabolite
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
5
|
|
Hydrogen bond donors
|
3
|
|
Rotatable bonds
|
3
|
|
Topological polar surface area
|
106.41
|
|
Molecular weight
|
132.05
|
|
XLogP
|
-4.43
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
NC(=O)CC(C(=O)O)N
|
|
Isomeric SMILES
|
NC(=O)C[C@@H](C(=O)O)N
|
|
InChI
|
InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9)/t2-/m0/s1
|
|
InChI Key
|
DCXYFEDJOCDNAF-REOHCLBHSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|