| 
                                                                Synonyms: L-α-lysophosphatidylinositol | LPI
                                 
                               
                               
                                
                                 
                                   
                                
                                
                                
                             Compound class: 
                                                            Metabolite
                                 
                                    
                                        Comment: The structure shown is representative of the lysophosphatidylinositol group of compounds. The carbon chain attached to the acyl group (shown here as CH3) can be of varying length.
                                    
                                  
                                   
                                    |  | 
                                                
                                        
                                           
                                                
                                                    | 2D Structure   
                                                                    |  
                                                    |   |  
                                                    | Physico-chemical Properties   
                                                                    |  |  
                                                        | 
                                                    
                                                        | Hydrogen bond acceptors | 12 |  
                                                        | Hydrogen bond donors | 7 |  
                                                        | Rotatable bonds | 8 |  
                                                        | Topological polar surface area | 213.25 |  
                                                        | Molecular weight | 376.08 |  
                                                        | XLogP | -3.67 |  
                                                        | No. Lipinski's rules broken | 2 |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  
                                                    | SMILES / InChI / InChIKey   
                                                                    |  |  
                                                        | 
                                                              
                                                                  
                                                            | Canonical SMILES | OC(COC(=O)C)COP(=O)(OC1C(O)C(O)C(C(C1O)O)O)O |  
                                                            | Isomeric SMILES | O[C@@H](COC(=O)C)COP(=O)(O[C@@H]1[C@H](O)[C@H](O)[C@H]([C@@H]([C@H]1O)O)O)O |  
                                                            | InChI | InChI=1S/C11H21O12P/c1-4(12)21-2-5(13)3-22-24(19,20)23-11-9(17)7(15)6(14)8(16)10(11)18/h5-11,13-18H,2-3H2,1H3,(H,19,20)/t5-,6-,7-,8+,9+,10+,11-/m0/s1 |  
                                                            | InChI Key | FBDBXJJQMHPGMP-IFUOQLDVSA-N |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  |