| 
                                                                Synonyms: AC1L4YI4 | bis(methylthio)gliotoxin | dimethylgliotoxin | FR 49175
                                 
                               
                               
                                
                                 
                                   
                                
                                
                                
                             Compound class: 
                                                            Natural product
                                 
                                    
                                        Comment: FR-49175 is a toxic metabolite with anthiphagocytic and immunosuppressive properties synthesised by fungi such as Aspergillus fumigatus. It is an analog of a gliotoxin known to inhibit PAF-induced platelet aggregation.
                                    
                                 |  | 
                                                
                                        
                                           
                                                
                                                    | 2D Structure   
                                                                    |  
                                                    |   |  
                                                    | Physico-chemical Properties   
                                                                    |  |  
                                                        | 
                                                    
                                                        | Hydrogen bond acceptors | 6 |  
                                                        | Hydrogen bond donors | 2 |  
                                                        | Rotatable bonds | 3 |  
                                                        | Topological polar surface area | 131.68 |  
                                                        | Molecular weight | 356.09 |  
                                                        | XLogP | -1.09 |  
                                                        | No. Lipinski's rules broken | 0 |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  
                                                    | SMILES / InChI / InChIKey   
                                                                    |  |  
                                                        | 
                                                              
                                                                  
                                                            | Canonical SMILES | CSC12CC3=CC=CC(C3N2C(=O)C(N(C1=O)C)(SC)CO)O |  
                                                            | Isomeric SMILES | CS[C@]12CC3=CC=C[C@@H]([C@H]3N2C(=O)[C@](N(C1=O)C)(SC)CO)O |  
                                                            | InChI | InChI=1S/C15H20N2O4S2/c1-16-12(20)14(22-2)7-9-5-4-6-10(19)11(9)17(14)13(21)15(16,8-18)23-3/h4-6,10-11,18-19H,7-8H2,1-3H3/t10-,11-,14+,15+/m0/s1 |  
                                                            | InChI Key | OVBAGMZLGLXSBN-UOVKNHIHSA-N |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  |