| 
                                                                Synonyms: (8S)-8-fluoroerythromycin A | P-0501A
                                 flurithromycin is an approved drug 
                                    
                                        Comment: Flurithromycin is a 14-membered macrolide antibacterial compound, originally isolated from Streptomyces erythraeus  using a mutational biosynthesis approach [4 ]. It is a fluorinated derivative of erythromycin  with improved acid stability.
                                    
                                 |  | 
                                                
                                        
                                           
                                                
                                                    | 2D Structure   
                                                                    |  
                                                    |   |  
                                                    | Physico-chemical Properties   
                                                                    |  |  
                                                        | 
                                                    
                                                        | Hydrogen bond acceptors | 14 |  
                                                        | Hydrogen bond donors | 5 |  
                                                        | Rotatable bonds | 7 |  
                                                        | Topological polar surface area | 193.91 |  
                                                        | Molecular weight | 751.92 |  
                                                        | XLogP | 1.19 |  
                                                        | No. Lipinski's rules broken | 2 |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  
                                                    | SMILES / InChI / InChIKey   
                                                                    |  |  
                                                        | 
                                                              
                                                                  
                                                            | Canonical SMILES | CC[C@@H]1[C@](C)([C@@H]([C@@H](C)C(=O)[C@](C)(C[C@](C)([C@@H]([C@@H](C)[C@@H]([C@@H](C)C(=O)O1)O[C@H]2C[C@](C)([C@H]([C@H](C)O2)O)OC)O[C@H]3[C@@H]([C@H](C[C@@H](C)O3)N(C)C)O)O)F)O)O |  
                                                            | Isomeric SMILES | CC[C@@H]1[C@@]([C@@H]([C@H](C(=O)[C@@](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]2C[C@@]([C@H]([C@@H](O2)C)O)(C)OC)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)O)(C)F)C)O)(C)O |  
                                                            | InChI | InChI=1S/C37H66FNO13/c1-14-24-37(10,46)29(42)21(5)28(41)34(7,38)17-35(8,45)31(52-33-26(40)23(39(11)12)15-18(2)48-33)19(3)27(20(4)32(44)50-24)51-25-16-36(9,47-13)30(43)22(6)49-25/h18-27,29-31,33,40,42-43,45-46H,14-17H2,1-13H3/t18-,19+,20-,21+,22+,23+,24-,25+,26-,27+,29-,30+,31-,33+,34+,35-,36-,37-/m1/s1 |  
                                                            | InChI Key | XOEUHCONYHZURQ-HNUBZJOYSA-N |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  |