| 
                                                                Synonyms: IQM-97,423
                                 
                               
                               
                                
                                 
                                   
                                
                                
                                
                             
                                    
                                  
                                   
                                    |  | 
                                                
                                        
                                           
                                                
                                                    | 2D Structure   
                                                                    |  
                                                    |   |  
                                                    | Physico-chemical Properties   
                                                                    |  |  
                                                        | 
                                                    
                                                        | Hydrogen bond acceptors | 9 |  
                                                        | Hydrogen bond donors | 4 |  
                                                        | Rotatable bonds | 11 |  
                                                        | Topological polar surface area | 126.64 |  
                                                        | Molecular weight | 558.3 |  
                                                        | XLogP | 3.1 |  
                                                        | No. Lipinski's rules broken | 0 |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  
                                                    | SMILES / InChI / InChIKey   
                                                                    |  |  
                                                        | 
                                                              
                                                                  
                                                            | Canonical SMILES | O=C(NC(C)(C)C)NC(C(=O)NC1CCCN2C1CC(=O)N(C2=O)Cc1ccccc1)Cc1c[nH]c2c1cccc2 |  
                                                            | Isomeric SMILES | O=C(NC(C)(C)C)N[C@H](C(=O)N[C@@H]1CCCN2[C@H]1CC(=O)N(C2=O)Cc1ccccc1)Cc1c[nH]c2c1cccc2 |  
                                                            | InChI | InChI=1S/C31H38N6O4/c1-31(2,3)35-29(40)34-25(16-21-18-32-23-13-8-7-12-22(21)23)28(39)33-24-14-9-15-36-26(24)17-27(38)37(30(36)41)19-20-10-5-4-6-11-20/h4-8,10-13,18,24-26,32H,9,14-17,19H2,1-3H3,(H,33,39)(H2,34,35,40)/t24-,25+,26+/m1/s1 |  
                                                            | InChI Key | JQMXXJDAKTTXOB-ZNZIZOMTSA-N |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  |