| 
                               
                               
                                
                                 
                                   
                                
                                
                                
                             Compound class: 
                                                            Natural product
                                 
                                    
                                        Comment: Isolated from the leaves of Syagrus orinocensis. The structure of kallstroemin D is shown here without representing the compound's complex stereochemisty. Please see the listed reference for an image of the exact structure.
                                    
                                  
                                   
                                    |  | 
                                                
                                        
                                           
                                                
                                                    | 2D Structure   
                                                                    |  
                                                    |   |  
                                                    | Physico-chemical Properties   
                                                                    |  |  
                                                        | 
                                                    
                                                        | Hydrogen bond acceptors | 20 |  
                                                        | Hydrogen bond donors | 10 |  
                                                        | Rotatable bonds | 9 |  
                                                        | Topological polar surface area | 294.6 |  
                                                        | Molecular weight | 1014.54 |  
                                                        | XLogP | 2.88 |  
                                                        | No. Lipinski's rules broken | 2 |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  
                                                    | SMILES / InChI / InChIKey   
                                                                    |  |  
                                                        | 
                                                              
                                                                  
                                                            | Canonical SMILES | CC1CCC2(OC1)OC1C(C2C)C2(C(C1)C1CC=C3C(C1CC2)(C)CCC(C3)OC1OC(COC2OC(C)C(C(C2OC2(CC(O)C(C(O2)C)O)OC2OC(C)C(C(C2O)O)O)O)O)C(C(C1O)O)O)C |  
                                                            | Isomeric SMILES | CC1CCC2(OC1)OC1C(C2C)C2(C(C1)C1CC=C3C(C1CC2)(C)CCC(C3)OC1OC(COC2OC(C)C(C(C2OC2(CC(O)C(C(O2)C)O)OC2OC(C)C(C(C2O)O)O)O)O)C(C(C1O)O)O)C |  
                                                            | InChI | InChI=1S/C51H82O20/c1-21-10-15-50(63-19-21)22(2)34-32(69-50)17-30-28-9-8-26-16-27(11-13-48(26,6)29(28)12-14-49(30,34)7)66-45-42(60)40(58)38(56)33(67-45)20-62-47-44(41(59)37(55)24(4)65-47)70-51(18-31(52)35(53)25(5)68-51)71-46-43(61)39(57)36(54)23(3)64-46/h8,21-25,27-47,52-61H,9-20H2,1-7H3 |  
                                                            | InChI Key | JXANHBVHGVNOQZ-UHFFFAOYSA-N |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  |