|
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
1
|
|
Hydrogen bond donors
|
0
|
|
Rotatable bonds
|
16
|
|
Topological polar surface area
|
37.83
|
|
Molecular weight
|
446.36
|
|
XLogP
|
9.32
|
|
No. Lipinski's rules broken
|
2
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CC(CCC=C(C)C)SCCC(=CCCC=C(CCC=C(CCC1OC1(C)C)C)C)C
|
|
Isomeric SMILES
|
CC(CCC=C(C)C)SCC/C(=C/CC/C=C(/CC/C=C(/CCC1OC1(C)C)\C)\C)/C
|
|
InChI
|
InChI=1S/C29H50OS/c1-23(2)13-11-18-27(6)31-22-21-26(5)15-10-9-14-24(3)16-12-17-25(4)19-20-28-29(7,8)30-28/h13-15,17,27-28H,9-12,16,18-22H2,1-8H3/b24-14+,25-17+,26-15+
|
|
InChI Key
|
CRZHANPLXOIADK-YNWRIEOZSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|