| 
                                                                Synonyms: 5-oxo-15-hydroxy-(6E,8Z,11Z,13E)-eicosatetraenoic acid
                                 
                               
                               
                                
                                 
                                   
                                
                                
                                
                             Compound class: 
                                                            Metabolite
                                 
                                    
                                  
                                   
                                    |  | 
                                                
                                        
                                           
                                                
                                                    | 2D Structure   
                                                                    |  
                                                    |   |  
                                                    | Physico-chemical Properties   
                                                                    |  |  
                                                        | 
                                                    
                                                        | Hydrogen bond acceptors | 4 |  
                                                        | Hydrogen bond donors | 2 |  
                                                        | Rotatable bonds | 14 |  
                                                        | Topological polar surface area | 74.6 |  
                                                        | Molecular weight | 334.21 |  
                                                        | XLogP | 4.42 |  
                                                        | No. Lipinski's rules broken | 1 |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  
                                                    | SMILES / InChI / InChIKey   
                                                                    |  |  
                                                        | 
                                                              
                                                                  
                                                            | Canonical SMILES | CCCCCC(C=CC=CCC=CC=CC(=O)CCCC(=O)O)O |  
                                                            | Isomeric SMILES | CCCCC[C@@H](/C=C/C=C\C/C=C\C=C\C(=O)CCCC(=O)O)O |  
                                                            | InChI | InChI=1S/C20H30O4/c1-2-3-9-13-18(21)14-10-7-5-4-6-8-11-15-19(22)16-12-17-20(23)24/h5-8,10-11,14-15,18,21H,2-4,9,12-13,16-17H2,1H3,(H,23,24)/b7-5-,8-6-,14-10+,15-11+/t18-/m0/s1 |  
                                                            | InChI Key | RIUDRKHGFDAKPO-WWWYWCMOSA-N |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  |