| 
                                                                Synonyms: Pavulon®
                                 pancuronium is an approved drug (FDA (1990)) 
                                    
                                        Comment: Pancuronium is a non-depolarizing curare-mimetic muscle relaxant, whose main action is as competitive acetylcholine antagonist at nicotinic acetylcholine receptors at  neuromuscular junctions. Pancuronium is notoriously one of the components of the lethal injection in administration of the death penalty.
                                    
                                 |  | 
                                                
                                        
                                           
                                                
                                                    | 2D Structure   
                                                                    |  
                                                    |   |  
                                                    | Physico-chemical Properties   
                                                                    |  |  
                                                        | 
                                                    
                                                        | Hydrogen bond acceptors | 4 |  
                                                        | Hydrogen bond donors | 0 |  
                                                        | Rotatable bonds | 6 |  
                                                        | Topological polar surface area | 52.6 |  
                                                        | Molecular weight | 572.46 |  
                                                        | XLogP | 6.59 |  
                                                        | No. Lipinski's rules broken | 1 |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  
                                                    | SMILES / InChI / InChIKey   
                                                                    |  |  
                                                        | 
                                                              
                                                                  
                                                            | Canonical SMILES | CC(=O)OC1CC2CCC3C(C2(CC1[N+]1(C)CCCCC1)C)CCC1(C3CC(C1OC(=O)C)[N+]1(C)CCCCC1)C |  
                                                            | Isomeric SMILES | CC(=O)O[C@H]1C[C@@H]2CC[C@@H]3[C@@H]([C@]2(C[C@@H]1[N+]1(C)CCCCC1)C)CC[C@]1([C@H]3C[C@@H]([C@@H]1OC(=O)C)[N+]1(C)CCCCC1)C |  
                                                            | InChI | InChI=1S/C35H60N2O4/c1-24(38)40-32-21-26-13-14-27-28(35(26,4)23-31(32)37(6)19-11-8-12-20-37)15-16-34(3)29(27)22-30(33(34)41-25(2)39)36(5)17-9-7-10-18-36/h26-33H,7-23H2,1-6H3/q+2/t26-,27+,28-,29-,30-,31-,32-,33-,34-,35-/m0/s1 |  
                                                            | InChI Key | GVEAYVLWDAFXET-XGHATYIMSA-N |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  |