|
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
4
|
|
Hydrogen bond donors
|
2
|
|
Rotatable bonds
|
9
|
|
Topological polar surface area
|
85.52
|
|
Molecular weight
|
376.19
|
|
XLogP
|
2.7
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
OC(CC(CC(=O)[O-])O)CCc1c(C)n(cc1c1ccc(cc1)F)C(C)C
|
|
Isomeric SMILES
|
O[C@@H](C[C@H](CC(=O)[O-])O)CCc1c(C)n(cc1c1ccc(cc1)F)C(C)C
|
|
InChI
|
InChI=1S/C21H28FNO4/c1-13(2)23-12-20(15-4-6-16(22)7-5-15)19(14(23)3)9-8-17(24)10-18(25)11-21(26)27/h4-7,12-13,17-18,24-25H,8-11H2,1-3H3,(H,26,27)/p-1/t17-,18-/m1/s1
|
|
InChI Key
|
LJBGBXVAGFAMLZ-QZTJIDSGSA-M
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|