| 
                                                                Synonyms: L 054522 | L054522
                                 
                                    
                                  
                                   
                                    |  | 
                                                
                                        
                                           
                                                
                                                    | 2D Structure   
                                                                    |  
                                                    |   |  
                                                    | Physico-chemical Properties   
                                                                    |  |  
                                                        | 
                                                    
                                                        | Hydrogen bond acceptors | 9 |  
                                                        | Hydrogen bond donors | 5 |  
                                                        | Rotatable bonds | 16 |  
                                                        | Topological polar surface area | 167.34 |  
                                                        | Molecular weight | 645.36 |  
                                                        | XLogP | 3.38 |  
                                                        | No. Lipinski's rules broken | 1 |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  
                                                    | SMILES / InChI / InChIKey   
                                                                    |  |  
                                                        | 
                                                              
                                                                  
                                                            | Canonical SMILES | NCCCCC(C(=O)OC(C)(C)C)NC(=O)C(C(c1c[nH]c2c1cccc2)C)NC(=O)N1CCC(CC1)n1c(=O)[nH]c2c1cccc2 |  
                                                            | Isomeric SMILES | NCCCC[C@@H](C(=O)OC(C)(C)C)NC(=O)[C@@H]([C@H](c1c[nH]c2c1cccc2)C)NC(=O)N1CCC(CC1)n1c(=O)[nH]c2c1cccc2 |  
                                                            | InChI | InChI=1S/C35H47N7O5/c1-22(25-21-37-26-12-6-5-11-24(25)26)30(31(43)38-28(14-9-10-18-36)32(44)47-35(2,3)4)40-33(45)41-19-16-23(17-20-41)42-29-15-8-7-13-27(29)39-34(42)46/h5-8,11-13,15,21-23,28,30,37H,9-10,14,16-20,36H2,1-4H3,(H,38,43)(H,39,46)(H,40,45)/t22-,28-,30+/m0/s1 |  
                                                            | InChI Key | WFCIXKAZBUIFTR-PKIMSIDOSA-N |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  |