|
Compound class:
Metabolite
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
6
|
|
Hydrogen bond donors
|
5
|
|
Rotatable bonds
|
5
|
|
Topological polar surface area
|
118.22
|
|
Molecular weight
|
180.06
|
|
XLogP
|
-3.33
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
OCC(C(C(C(C=O)O)O)O)O
|
|
Isomeric SMILES
|
OC[C@@H]([C@@H]([C@H]([C@@H](C=O)O)O)O)O
|
|
InChI
|
InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m1/s1
|
|
InChI Key
|
GZCGUPFRVQAUEE-VANKVMQKSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|