|
Synonyms: epipregnanolone sulfate
Compound class:
Metabolite
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
5
|
|
Hydrogen bond donors
|
1
|
|
Rotatable bonds
|
3
|
|
Topological polar surface area
|
89.05
|
|
Molecular weight
|
398.21
|
|
XLogP
|
4.8
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CC(=O)C1CCC2C1(C)CCC1C2CCC2C1(C)CCC(C2)OS(=O)(=O)O
|
|
Isomeric SMILES
|
CC(=O)C1CCC2[C@]1(C)CCC1C2CC[C@H]2[C@]1(C)CC[C@@H](C2)OS(=O)(=O)O
|
|
InChI
|
InChI=1S/C21H34O5S/c1-13(22)17-6-7-18-16-5-4-14-12-15(26-27(23,24)25)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19H,4-12H2,1-3H3,(H,23,24,25)/t14-,15+,16?,17?,18?,19?,20+,21-/m1/s1
|
|
InChI Key
|
MENQCIVHHONJLU-ACWDEBGSSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|