|
Compound class:
Metabolite
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
4
|
|
Hydrogen bond donors
|
3
|
|
Rotatable bonds
|
14
|
|
Topological polar surface area
|
77.76
|
|
Molecular weight
|
336.23
|
|
XLogP
|
5.15
|
|
No. Lipinski's rules broken
|
2
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CCCCCCC=CC=CC=CC=CC(C(CCCC(=O)O)O)O
|
|
Isomeric SMILES
|
CCCCCC/C=C/C=C/C=C/C=C/[C@H]([C@H](CCCC(=O)O)O)O
|
|
InChI
|
InChI=1S/C20H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(21)19(22)16-14-17-20(23)24/h7-13,15,18-19,21-22H,2-6,14,16-17H2,1H3,(H,23,24)/b8-7+,10-9+,12-11+,15-13+/t18-,19+/m1/s1
|
|
InChI Key
|
SJIRTDBAYKOBAL-COJKCNNISA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|